C11H18 — CID 10931616
(1S,2R,5R,7S)-2-methyltricyclo[5.3.0.02,5]decane (PubChem CID 10931616) has the molecular formula C11H18 and a molecular weight of 150.27 g/mol. Its IUPAC name is (1S,2R,5R,7S)-2-methyltricyclo[5.3.0.02,5]decane.
| Compound Name | (1S,2R,5R,7S)-2-methyltricyclo[5.3.0.02,5]decane |
|---|---|
| PubChem CID | 10931616 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (1S,2R,5R,7S)-2-methyltricyclo[5.3.0.02,5]decane |
| SMILES | C[C@@]12CC[C@@H]1C[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C11H18/c1-11-6-5-9(11)7-8-3-2-4-10(8)11/h8-10H,2-7H2,1H3/t8-,9+,10-,11+/m0/s1 |
| InChIKey | WLRFFUWJGLHUDA-ZRUFSTJUSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |