About ethyl thiolane-2-carboxylate
ethyl thiolane-2-carboxylate (PubChem CID 10931735) has the molecular formula C7H12O2S
and a molecular weight of 160.24 g/mol. Its IUPAC name is ethyl thiolane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl thiolane-2-carboxylate |
| PubChem CID | 10931735 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | ethyl thiolane-2-carboxylate |
| SMILES | CCOC(=O)C1CCCS1 |
| InChI | InChI=1S/C7H12O2S/c1-2-9-7(8)6-4-3-5-10-6/h6H,2-5H2,1H3 |
| InChIKey | VHDROBMEJHQSNW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl thiolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl thiolane-2-carboxylate?
The IUPAC name of ethyl thiolane-2-carboxylate (CID 10931735) is ethyl thiolane-2-carboxylate.
What is the SMILES notation for ethyl thiolane-2-carboxylate?
The canonical SMILES for ethyl thiolane-2-carboxylate is CCOC(=O)C1CCCS1.
What is the InChIKey of ethyl thiolane-2-carboxylate?
The InChIKey is VHDROBMEJHQSNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S/c1-2-9-7(8)6-4-3-5-10-6/h6H,2-5H2,1H3.
What are the key properties of ethyl thiolane-2-carboxylate?
ethyl thiolane-2-carboxylate has a molecular weight of 160.24 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl thiolane-2-carboxylate is sourced from PubChem (CID 10931735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).