C18H13F3N4O2 — CID 109317648
2-(3-methoxyanilino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide (PubChem CID 109317648) has the molecular formula C18H13F3N4O2 and a molecular weight of 374.32 g/mol. Its IUPAC name is 2-(3-methoxyanilino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(3-methoxyanilino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109317648 |
| Molecular Formula | C18H13F3N4O2 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-(3-methoxyanilino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
| SMILES | COc1cccc(Nc2nccc(C(=O)Nc3ccc(F)c(F)c3F)n2)c1 |
| InChI | InChI=1S/C18H13F3N4O2/c1-27-11-4-2-3-10(9-11)23-18-22-8-7-14(25-18)17(26)24-13-6-5-12(19)15(20)16(13)21/h2-9H,1H3,(H,24,26)(H,22,23,25) |
| InChIKey | XNJJABRIJLYIPB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|