C9H10O3 — CID 10931793
(1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 10931793) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is (1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 10931793 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (1S,2S,6R,7R)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]3CC[C@H](C3)[C@@H]12 |
| InChI | InChI=1S/C9H10O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h4-7H,1-3H2/t4-,5+,6-,7+ |
| InChIKey | LQOPXMZSGSTGMF-UMRXKNAASA-N |
| XLogP | 0.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|