C19H16F2N4O3 — CID 109318035
N-(3,4-difluorophenyl)-2-(2,5-dimethoxyanilino)pyrimidine-4-carboxamide (PubChem CID 109318035) has the molecular formula C19H16F2N4O3 and a molecular weight of 386.36 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(2,5-dimethoxyanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-2-(2,5-dimethoxyanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109318035 |
| Molecular Formula | C19H16F2N4O3 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(2,5-dimethoxyanilino)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(OC)c(Nc2nccc(C(=O)Nc3ccc(F)c(F)c3)n2)c1 |
| InChI | InChI=1S/C19H16F2N4O3/c1-27-12-4-6-17(28-2)16(10-12)25-19-22-8-7-15(24-19)18(26)23-11-3-5-13(20)14(21)9-11/h3-10H,1-2H3,(H,23,26)(H,22,24,25) |
| InChIKey | LOFJSGIHTNSBNJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |