C21H21F2N5O — CID 109318417
N-[4-(diethylamino)phenyl]-2-(2,4-difluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109318417) has the molecular formula C21H21F2N5O and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-(2,4-difluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2-(2,4-difluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109318417 |
| Molecular Formula | C21H21F2N5O |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-(2,4-difluoroanilino)pyrimidine-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccnc(Nc3ccc(F)cc3F)n2)cc1 |
| InChI | InChI=1S/C21H21F2N5O/c1-3-28(4-2)16-8-6-15(7-9-16)25-20(29)19-11-12-24-21(27-19)26-18-10-5-14(22)13-17(18)23/h5-13H,3-4H2,1-2H3,(H,25,29)(H,24,26,27) |
| InChIKey | AGXLOKFSKAZJNG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|