About (3S,6R)-3,6-diethoxycyclohexene
(3S,6R)-3,6-diethoxycyclohexene (PubChem CID 10931862) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (3S,6R)-3,6-diethoxycyclohexene.
Molecular Properties
| Compound Name | (3S,6R)-3,6-diethoxycyclohexene |
| PubChem CID | 10931862 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3S,6R)-3,6-diethoxycyclohexene |
| SMILES | CCO[C@@H]1C=C[C@H](OCC)CC1 |
| InChI | InChI=1S/C10H18O2/c1-3-11-9-5-7-10(8-6-9)12-4-2/h5,7,9-10H,3-4,6,8H2,1-2H3/t9-,10+ |
| InChIKey | WEBGHMJGXDZMHT-AOOOYVTPSA-N |
| XLogP | 2.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,6R)-3,6-diethoxycyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6R)-3,6-diethoxycyclohexene?
The IUPAC name of (3S,6R)-3,6-diethoxycyclohexene (CID 10931862) is (3S,6R)-3,6-diethoxycyclohexene.
What is the SMILES notation for (3S,6R)-3,6-diethoxycyclohexene?
The canonical SMILES for (3S,6R)-3,6-diethoxycyclohexene is CCO[C@@H]1C=C[C@H](OCC)CC1.
What is the InChIKey of (3S,6R)-3,6-diethoxycyclohexene?
The InChIKey is WEBGHMJGXDZMHT-AOOOYVTPSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-11-9-5-7-10(8-6-9)12-4-2/h5,7,9-10H,3-4,6,8H2,1-2H3/t9-,10+.
What are the key properties of (3S,6R)-3,6-diethoxycyclohexene?
(3S,6R)-3,6-diethoxycyclohexene has a molecular weight of 170.25 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6R)-3,6-diethoxycyclohexene is sourced from PubChem (CID 10931862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).