C18H11F2N5O — CID 109318638
N-(2-cyanophenyl)-2-(2,4-difluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109318638) has the molecular formula C18H11F2N5O and a molecular weight of 351.32 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(2,4-difluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-cyanophenyl)-2-(2,4-difluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109318638 |
| Molecular Formula | C18H11F2N5O |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(2-cyanophenyl)-2-(2,4-difluoroanilino)pyrimidine-4-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1ccnc(Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C18H11F2N5O/c19-12-5-6-15(13(20)9-12)24-18-22-8-7-16(25-18)17(26)23-14-4-2-1-3-11(14)10-21/h1-9H,(H,23,26)(H,22,24,25) |
| InChIKey | JBYDMSGCKOYZDZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |