About 5-nitrosodecane
5-nitrosodecane (PubChem CID 10931874) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 5-nitrosodecane.
Molecular Properties
| Compound Name | 5-nitrosodecane |
| PubChem CID | 10931874 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 5-nitrosodecane |
| SMILES | CCCCCC(CCCC)N=O |
| InChI | InChI=1S/C10H21NO/c1-3-5-7-9-10(11-12)8-6-4-2/h10H,3-9H2,1-2H3 |
| InChIKey | IQPYXEGHXVKLML-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrosodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrosodecane?
The IUPAC name of 5-nitrosodecane (CID 10931874) is 5-nitrosodecane.
What is the SMILES notation for 5-nitrosodecane?
The canonical SMILES for 5-nitrosodecane is CCCCCC(CCCC)N=O.
What is the InChIKey of 5-nitrosodecane?
The InChIKey is IQPYXEGHXVKLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-3-5-7-9-10(11-12)8-6-4-2/h10H,3-9H2,1-2H3.
What are the key properties of 5-nitrosodecane?
5-nitrosodecane has a molecular weight of 171.28 g/mol, XLogP of 3.89, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrosodecane is sourced from PubChem (CID 10931874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).