C14H23N5O — CID 109318879
(4-methylpiperazin-1-yl)-[6-methyl-2-(propylamino)pyrimidin-4-yl]methanone (PubChem CID 109318879) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[6-methyl-2-(propylamino)pyrimidin-4-yl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[6-methyl-2-(propylamino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109318879 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[6-methyl-2-(propylamino)pyrimidin-4-yl]methanone |
| SMILES | CCCNc1nc(C)cc(C(=O)N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C14H23N5O/c1-4-5-15-14-16-11(2)10-12(17-14)13(20)19-8-6-18(3)7-9-19/h10H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | OTHHMLMEODCYMP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |