C13H20 — CID 10931976
5-but-3-enyl-1,2,3,4-tetramethylcyclopenta-1,3-diene (PubChem CID 10931976) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 5-but-3-enyl-1,2,3,4-tetramethylcyclopenta-1,3-diene.
| Compound Name | 5-but-3-enyl-1,2,3,4-tetramethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 10931976 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 5-but-3-enyl-1,2,3,4-tetramethylcyclopenta-1,3-diene |
| SMILES | C=CCCC1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C13H20/c1-6-7-8-13-11(4)9(2)10(3)12(13)5/h6,13H,1,7-8H2,2-5H3 |
| InChIKey | YIUZYAXUMOJLKR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|