About benzyl N-ethenylcarbamate
benzyl N-ethenylcarbamate (PubChem CID 10931982) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is benzyl N-ethenylcarbamate.
Molecular Properties
| Compound Name | benzyl N-ethenylcarbamate |
| PubChem CID | 10931982 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | benzyl N-ethenylcarbamate |
| SMILES | C=CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C10H11NO2/c1-2-11-10(12)13-8-9-6-4-3-5-7-9/h2-7H,1,8H2,(H,11,12) |
| InChIKey | YGBQZFPEMRCQRY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl N-ethenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-ethenylcarbamate?
The IUPAC name of benzyl N-ethenylcarbamate (CID 10931982) is benzyl N-ethenylcarbamate.
What is the SMILES notation for benzyl N-ethenylcarbamate?
The canonical SMILES for benzyl N-ethenylcarbamate is C=CNC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-ethenylcarbamate?
The InChIKey is YGBQZFPEMRCQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-2-11-10(12)13-8-9-6-4-3-5-7-9/h2-7H,1,8H2,(H,11,12).
What are the key properties of benzyl N-ethenylcarbamate?
benzyl N-ethenylcarbamate has a molecular weight of 177.20 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-ethenylcarbamate is sourced from PubChem (CID 10931982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).