About 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde
1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde (PubChem CID 10932102) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde |
| PubChem CID | 10932102 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde |
| SMILES | CSc1nc(C=O)c(C=O)n1C |
| InChI | InChI=1S/C7H8N2O2S/c1-9-6(4-11)5(3-10)8-7(9)12-2/h3-4H,1-2H3 |
| InChIKey | BTQMMOIKESOGRI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde?
The IUPAC name of 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde (CID 10932102) is 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde.
What is the SMILES notation for 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde?
The canonical SMILES for 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde is CSc1nc(C=O)c(C=O)n1C.
What is the InChIKey of 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde?
The InChIKey is BTQMMOIKESOGRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c1-9-6(4-11)5(3-10)8-7(9)12-2/h3-4H,1-2H3.
What are the key properties of 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde?
1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde has a molecular weight of 184.22 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-methylsulfanylimidazole-4,5-dicarbaldehyde is sourced from PubChem (CID 10932102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).