C7H16N6 — CID 10932107
3-N-[3-(dimethylamino)propyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 10932107) has the molecular formula C7H16N6 and a molecular weight of 184.25 g/mol. Its IUPAC name is 3-N-[3-(dimethylamino)propyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-(dimethylamino)propyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 10932107 |
| Molecular Formula | C7H16N6 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 3-N-[3-(dimethylamino)propyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CN(C)CCCNc1n[nH]c(N)n1 |
| InChI | InChI=1S/C7H16N6/c1-13(2)5-3-4-9-7-10-6(8)11-12-7/h3-5H2,1-2H3,(H4,8,9,10,11,12) |
| InChIKey | UVNGMFCPDCPFSU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|