About (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol
(E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol (PubChem CID 10932113) has the molecular formula C12H22O
and a molecular weight of 184.32 g/mol. Its IUPAC name is (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol |
| PubChem CID | 10932113 |
| Molecular Formula | C12H22O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol |
| SMILES | [2H]C([2H])(O)/C(C)=C/CCC1CCCCC1 |
| InChI | InChI=1S/C12H22O/c1-11(10-13)6-5-9-12-7-3-2-4-8-12/h6,12-13H,2-5,7-10H2,1H3/b11-6+/i10D2 |
| InChIKey | VMHFRALCFXVQIY-QRDLXZQUSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol?
The IUPAC name of (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol (CID 10932113) is (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol.
What is the SMILES notation for (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol?
The canonical SMILES for (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol is [2H]C([2H])(O)/C(C)=C/CCC1CCCCC1.
What is the InChIKey of (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol?
The InChIKey is VMHFRALCFXVQIY-QRDLXZQUSA-N. The full InChI is InChI=1S/C12H22O/c1-11(10-13)6-5-9-12-7-3-2-4-8-12/h6,12-13H,2-5,7-10H2,1H3/b11-6+/i10D2.
What are the key properties of (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol?
(E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol has a molecular weight of 184.32 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-cyclohexyl-1,1-dideuterio-2-methylpent-2-en-1-ol is sourced from PubChem (CID 10932113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).