C19H22N4O3 — CID 109321902
ethyl 2-[[4-methyl-6-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]amino]benzoate (PubChem CID 109321902) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is ethyl 2-[[4-methyl-6-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 2-[[4-methyl-6-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 109321902 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | ethyl 2-[[4-methyl-6-(pyrrolidine-1-carbonyl)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1nc(C)cc(C(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C19H22N4O3/c1-3-26-18(25)14-8-4-5-9-15(14)21-19-20-13(2)12-16(22-19)17(24)23-10-6-7-11-23/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3,(H,20,21,22) |
| InChIKey | ZUNYVCHRDJEVKC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |