C12H19NO — CID 10932306
1-(1,2,3,5,6,8a-hexahydroindolizin-8-yl)butan-1-one (PubChem CID 10932306) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(1,2,3,5,6,8a-hexahydroindolizin-8-yl)butan-1-one.
| Compound Name | 1-(1,2,3,5,6,8a-hexahydroindolizin-8-yl)butan-1-one |
|---|---|
| PubChem CID | 10932306 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-(1,2,3,5,6,8a-hexahydroindolizin-8-yl)butan-1-one |
| SMILES | CCCC(=O)C1=CCCN2CCCC12 |
| InChI | InChI=1S/C12H19NO/c1-2-5-12(14)10-6-3-8-13-9-4-7-11(10)13/h6,11H,2-5,7-9H2,1H3 |
| InChIKey | PRGCCJPXJZTXMB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |