C17H23N5O4S — CID 109323530
2-(2-methoxyethylamino)-6-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide (PubChem CID 109323530) has the molecular formula C17H23N5O4S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-6-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide.
| Compound Name | 2-(2-methoxyethylamino)-6-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109323530 |
| Molecular Formula | C17H23N5O4S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-(2-methoxyethylamino)-6-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide |
| SMILES | COCCNc1nc(C)cc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C17H23N5O4S/c1-12-11-15(22-17(21-12)20-9-10-26-2)16(23)19-8-7-13-3-5-14(6-4-13)27(18,24)25/h3-6,11H,7-10H2,1-2H3,(H,19,23)(H2,18,24,25)(H,20,21,22) |
| InChIKey | CMNJRLHZYCIXMG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|