About 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one
4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 1093237) has the molecular formula C14H12N2O3S
and a molecular weight of 288.33 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one |
| PubChem CID | 1093237 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C14H12N2O3S/c17-14-10-16(13-9-5-4-8-12(13)15-14)20(18,19)11-6-2-1-3-7-11/h1-9H,10H2,(H,15,17) |
| InChIKey | UTVUJCAHSHFXCQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one?
The IUPAC name of 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one (CID 1093237) is 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one.
What is the SMILES notation for 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one?
The canonical SMILES for 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one is O=C1CN(S(=O)(=O)c2ccccc2)c2ccccc2N1.
What is the InChIKey of 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one?
The InChIKey is UTVUJCAHSHFXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3S/c17-14-10-16(13-9-5-4-8-12(13)15-14)20(18,19)11-6-2-1-3-7-11/h1-9H,10H2,(H,15,17).
What are the key properties of 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one?
4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one has a molecular weight of 288.33 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfonyl)-1,3-dihydroquinoxalin-2-one is sourced from PubChem (CID 1093237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).