C18H24N4O3 — CID 109323874
N-[(2-methoxyphenyl)methyl]-2-(3-methoxypropylamino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109323874) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-2-(3-methoxypropylamino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-2-(3-methoxypropylamino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109323874 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-2-(3-methoxypropylamino)-6-methylpyrimidine-4-carboxamide |
| SMILES | COCCCNc1nc(C)cc(C(=O)NCc2ccccc2OC)n1 |
| InChI | InChI=1S/C18H24N4O3/c1-13-11-15(22-18(21-13)19-9-6-10-24-2)17(23)20-12-14-7-4-5-8-16(14)25-3/h4-5,7-8,11H,6,9-10,12H2,1-3H3,(H,20,23)(H,19,21,22) |
| InChIKey | MDXJNOXIPOCWTF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|