C22H31N5O2 — CID 109324675
N-[4-(diethylamino)-2-methylphenyl]-6-methyl-2-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109324675) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-6-methyl-2-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-6-methyl-2-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109324675 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-6-methyl-2-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cc(C)nc(NCC3CCCO3)n2)c(C)c1 |
| InChI | InChI=1S/C22H31N5O2/c1-5-27(6-2)17-9-10-19(15(3)12-17)25-21(28)20-13-16(4)24-22(26-20)23-14-18-8-7-11-29-18/h9-10,12-13,18H,5-8,11,14H2,1-4H3,(H,25,28)(H,23,24,26) |
| InChIKey | NQVMGPROTGHOQW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|