C8H14N2O4 — CID 10932517
3-(2,3-dihydroxypropyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 10932517) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(2,3-dihydroxypropyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10932517 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CC(O)CO)C1=O |
| InChI | InChI=1S/C8H14N2O4/c1-8(2)6(13)10(7(14)9-8)3-5(12)4-11/h5,11-12H,3-4H2,1-2H3,(H,9,14) |
| InChIKey | VGBQGFLBPWUKKO-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|