About 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene
6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene (PubChem CID 10932539) has the molecular formula C13H14S
and a molecular weight of 202.32 g/mol. Its IUPAC name is 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene.
Molecular Properties
| Compound Name | 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene |
| PubChem CID | 10932539 |
| Molecular Formula | C13H14S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene |
| SMILES | C#Cc1ccc2c(c1)C(C)(C)CCS2 |
| InChI | InChI=1S/C13H14S/c1-4-10-5-6-12-11(9-10)13(2,3)7-8-14-12/h1,5-6,9H,7-8H2,2-3H3 |
| InChIKey | KVHNVHGCQWNGLG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene?
The IUPAC name of 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene (CID 10932539) is 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene.
What is the SMILES notation for 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene?
The canonical SMILES for 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene is C#Cc1ccc2c(c1)C(C)(C)CCS2.
What is the InChIKey of 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene?
The InChIKey is KVHNVHGCQWNGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14S/c1-4-10-5-6-12-11(9-10)13(2,3)7-8-14-12/h1,5-6,9H,7-8H2,2-3H3.
What are the key properties of 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene?
6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene has a molecular weight of 202.32 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethynyl-4,4-dimethyl-2,3-dihydrothiochromene is sourced from PubChem (CID 10932539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).