C10H22O2Si — CID 10932545
[(2R,3S)-3-butyl-2-trimethylsilyloxiran-2-yl]methanol (PubChem CID 10932545) has the molecular formula C10H22O2Si and a molecular weight of 202.37 g/mol. Its IUPAC name is [(2R,3S)-3-butyl-2-trimethylsilyloxiran-2-yl]methanol.
| Compound Name | [(2R,3S)-3-butyl-2-trimethylsilyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 10932545 |
| Molecular Formula | C10H22O2Si |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | [(2R,3S)-3-butyl-2-trimethylsilyloxiran-2-yl]methanol |
| SMILES | CCCC[C@@H]1O[C@]1(CO)[Si](C)(C)C |
| InChI | InChI=1S/C10H22O2Si/c1-5-6-7-9-10(8-11,12-9)13(2,3)4/h9,11H,5-8H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | QLYOWOQZXARAAG-VHSXEESVSA-N |
| XLogP | 2.18 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|