C20H26ClN5O — CID 109326060
N-[2-(3-chlorophenyl)ethyl]-2-(4-ethylpiperazin-1-yl)-6-methylpyrimidine-4-carboxamide (PubChem CID 109326060) has the molecular formula C20H26ClN5O and a molecular weight of 387.92 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-(4-ethylpiperazin-1-yl)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-(4-ethylpiperazin-1-yl)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109326060 |
| Molecular Formula | C20H26ClN5O |
| Molecular Weight | 387.92 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-(4-ethylpiperazin-1-yl)-6-methylpyrimidine-4-carboxamide |
| SMILES | CCN1CCN(c2nc(C)cc(C(=O)NCCc3cccc(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C20H26ClN5O/c1-3-25-9-11-26(12-10-25)20-23-15(2)13-18(24-20)19(27)22-8-7-16-5-4-6-17(21)14-16/h4-6,13-14H,3,7-12H2,1-2H3,(H,22,27) |
| InChIKey | ULMDXXNTFYQIGH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.92 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |