C9H12N4O2 — CID 10932681
(1R,3R,5R,8S)-8-azido-5-(hydroxymethyl)-6-azatricyclo[4.3.0.01,3]nonan-7-one (PubChem CID 10932681) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is (1R,3R,5R,8S)-8-azido-5-(hydroxymethyl)-6-azatricyclo[4.3.0.01,3]nonan-7-one.
| Compound Name | (1R,3R,5R,8S)-8-azido-5-(hydroxymethyl)-6-azatricyclo[4.3.0.01,3]nonan-7-one |
|---|---|
| PubChem CID | 10932681 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (1R,3R,5R,8S)-8-azido-5-(hydroxymethyl)-6-azatricyclo[4.3.0.01,3]nonan-7-one |
| SMILES | [N-]=[N+]=N[C@H]1C[C@]23C[C@H]2C[C@H](CO)N3C1=O |
| InChI | InChI=1S/C9H12N4O2/c10-12-11-7-3-9-2-5(9)1-6(4-14)13(9)8(7)15/h5-7,14H,1-4H2/t5-,6-,7+,9-/m1/s1 |
| InChIKey | VZOZPAFNPBIGBR-JAGXHNFQSA-N |
| XLogP | 0.42 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|