C20H22N4O2 — CID 109326812
2-(furan-2-ylmethylamino)-6-methyl-N-(3-phenylpropyl)pyrimidine-4-carboxamide (PubChem CID 109326812) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(furan-2-ylmethylamino)-6-methyl-N-(3-phenylpropyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(furan-2-ylmethylamino)-6-methyl-N-(3-phenylpropyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109326812 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-(furan-2-ylmethylamino)-6-methyl-N-(3-phenylpropyl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCc2ccccc2)nc(NCc2ccco2)n1 |
| InChI | InChI=1S/C20H22N4O2/c1-15-13-18(24-20(23-15)22-14-17-10-6-12-26-17)19(25)21-11-5-9-16-7-3-2-4-8-16/h2-4,6-8,10,12-13H,5,9,11,14H2,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | VEROTAIFLASGMK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|