C24H28N4O — CID 109327405
N-(4-tert-butylphenyl)-6-methyl-2-[(2-methylphenyl)methylamino]pyrimidine-4-carboxamide (PubChem CID 109327405) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-6-methyl-2-[(2-methylphenyl)methylamino]pyrimidine-4-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-6-methyl-2-[(2-methylphenyl)methylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109327405 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-(4-tert-butylphenyl)-6-methyl-2-[(2-methylphenyl)methylamino]pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(C)(C)C)cc2)nc(NCc2ccccc2C)n1 |
| InChI | InChI=1S/C24H28N4O/c1-16-8-6-7-9-18(16)15-25-23-26-17(2)14-21(28-23)22(29)27-20-12-10-19(11-13-20)24(3,4)5/h6-14H,15H2,1-5H3,(H,27,29)(H,25,26,28) |
| InChIKey | NJVSALXGLABEBC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |