C22H23N5O2 — CID 109327539
2-(3-acetamidoanilino)-6-methyl-N-[(2-methylphenyl)methyl]pyrimidine-4-carboxamide (PubChem CID 109327539) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-(3-acetamidoanilino)-6-methyl-N-[(2-methylphenyl)methyl]pyrimidine-4-carboxamide.
| Compound Name | 2-(3-acetamidoanilino)-6-methyl-N-[(2-methylphenyl)methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109327539 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-(3-acetamidoanilino)-6-methyl-N-[(2-methylphenyl)methyl]pyrimidine-4-carboxamide |
| SMILES | CC(=O)Nc1cccc(Nc2nc(C)cc(C(=O)NCc3ccccc3C)n2)c1 |
| InChI | InChI=1S/C22H23N5O2/c1-14-7-4-5-8-17(14)13-23-21(29)20-11-15(2)24-22(27-20)26-19-10-6-9-18(12-19)25-16(3)28/h4-12H,13H2,1-3H3,(H,23,29)(H,25,28)(H,24,26,27) |
| InChIKey | UGEIYFXGXLEEIS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |