C19H26N4O — CID 109327701
6-methyl-2-(3-methylbutylamino)-N-[(3-methylphenyl)methyl]pyrimidine-4-carboxamide (PubChem CID 109327701) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 6-methyl-2-(3-methylbutylamino)-N-[(3-methylphenyl)methyl]pyrimidine-4-carboxamide.
| Compound Name | 6-methyl-2-(3-methylbutylamino)-N-[(3-methylphenyl)methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109327701 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 6-methyl-2-(3-methylbutylamino)-N-[(3-methylphenyl)methyl]pyrimidine-4-carboxamide |
| SMILES | Cc1cccc(CNC(=O)c2cc(C)nc(NCCC(C)C)n2)c1 |
| InChI | InChI=1S/C19H26N4O/c1-13(2)8-9-20-19-22-15(4)11-17(23-19)18(24)21-12-16-7-5-6-14(3)10-16/h5-7,10-11,13H,8-9,12H2,1-4H3,(H,21,24)(H,20,22,23) |
| InChIKey | ACTPYEFJHHOHSW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |