C20H26N4O — CID 109328241
azepan-1-yl-[2-[benzyl(methyl)amino]-6-methylpyrimidin-4-yl]methanone (PubChem CID 109328241) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is azepan-1-yl-[2-[benzyl(methyl)amino]-6-methylpyrimidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[2-[benzyl(methyl)amino]-6-methylpyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109328241 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | azepan-1-yl-[2-[benzyl(methyl)amino]-6-methylpyrimidin-4-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCCCCC2)nc(N(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C20H26N4O/c1-16-14-18(19(25)24-12-8-3-4-9-13-24)22-20(21-16)23(2)15-17-10-6-5-7-11-17/h5-7,10-11,14H,3-4,8-9,12-13,15H2,1-2H3 |
| InChIKey | DKEYOOCNKSWPCD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |