C12H20BNO2 — CID 10933004
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile (PubChem CID 10933004) has the molecular formula C12H20BNO2 and a molecular weight of 221.11 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile |
|---|---|
| PubChem CID | 10933004 |
| Molecular Formula | C12H20BNO2 |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile |
| SMILES | C=C(CCCC#N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H20BNO2/c1-10(8-6-7-9-14)13-15-11(2,3)12(4,5)16-13/h1,6-8H2,2-5H3 |
| InChIKey | VXCIAHVZKNKVFW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|