C24H26N4O — CID 109332521
2-(3,4-dihydro-2H-quinolin-1-yl)-6-methyl-N-(3-phenylpropyl)pyrimidine-4-carboxamide (PubChem CID 109332521) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-6-methyl-N-(3-phenylpropyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-6-methyl-N-(3-phenylpropyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109332521 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-6-methyl-N-(3-phenylpropyl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCc2ccccc2)nc(N2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C24H26N4O/c1-18-17-21(23(29)25-15-7-11-19-9-3-2-4-10-19)27-24(26-18)28-16-8-13-20-12-5-6-14-22(20)28/h2-6,9-10,12,14,17H,7-8,11,13,15-16H2,1H3,(H,25,29) |
| InChIKey | NTOMIUDCXMIZHF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|