C20H28N4O3 — CID 109332567
N-butyl-2-[2-(4-methoxyphenoxy)ethylamino]-N,6-dimethylpyrimidine-4-carboxamide (PubChem CID 109332567) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-butyl-2-[2-(4-methoxyphenoxy)ethylamino]-N,6-dimethylpyrimidine-4-carboxamide.
| Compound Name | N-butyl-2-[2-(4-methoxyphenoxy)ethylamino]-N,6-dimethylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109332567 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-butyl-2-[2-(4-methoxyphenoxy)ethylamino]-N,6-dimethylpyrimidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cc(C)nc(NCCOc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C20H28N4O3/c1-5-6-12-24(3)19(25)18-14-15(2)22-20(23-18)21-11-13-27-17-9-7-16(26-4)8-10-17/h7-10,14H,5-6,11-13H2,1-4H3,(H,21,22,23) |
| InChIKey | NZAPDHOLWHDPGO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|