C11H22O3Si — CID 10933366
(3R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dideuteriooxolan-2-one (PubChem CID 10933366) has the molecular formula C11H22O3Si and a molecular weight of 232.39 g/mol. Its IUPAC name is (3R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dideuteriooxolan-2-one.
| Compound Name | (3R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dideuteriooxolan-2-one |
|---|---|
| PubChem CID | 10933366 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dideuteriooxolan-2-one |
| SMILES | [2H][C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)OC(=O)[C@@H]1[2H] |
| InChI | InChI=1S/C11H22O3Si/c1-11(2,3)15(4,5)13-8-9-6-7-10(12)14-9/h9H,6-8H2,1-5H3/t9-/m0/s1/i6D,7D/t6-,7+,9- |
| InChIKey | PUVKTUGKESTBDE-LMCSMQJISA-N |
| XLogP | 2.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|