About 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran
4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran (PubChem CID 10933375) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran |
| PubChem CID | 10933375 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran |
| SMILES | CC1=C(C)CC(c2ccc([N+](=O)[O-])cc2)OC1 |
| InChI | InChI=1S/C13H15NO3/c1-9-7-13(17-8-10(9)2)11-3-5-12(6-4-11)14(15)16/h3-6,13H,7-8H2,1-2H3 |
| InChIKey | RZZYVFBHPJBNIA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran?
The IUPAC name of 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran (CID 10933375) is 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran.
What is the SMILES notation for 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran?
The canonical SMILES for 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran is CC1=C(C)CC(c2ccc([N+](=O)[O-])cc2)OC1.
What is the InChIKey of 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran?
The InChIKey is RZZYVFBHPJBNIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-9-7-13(17-8-10(9)2)11-3-5-12(6-4-11)14(15)16/h3-6,13H,7-8H2,1-2H3.
What are the key properties of 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran?
4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran has a molecular weight of 233.27 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-(4-nitrophenyl)-3,6-dihydro-2H-pyran is sourced from PubChem (CID 10933375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).