C20H23F3N4O — CID 109333892
(2-ethylpiperidin-1-yl)-[6-methyl-2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]methanone (PubChem CID 109333892) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is (2-ethylpiperidin-1-yl)-[6-methyl-2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]methanone.
| Compound Name | (2-ethylpiperidin-1-yl)-[6-methyl-2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109333892 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (2-ethylpiperidin-1-yl)-[6-methyl-2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]methanone |
| SMILES | CCC1CCCCN1C(=O)c1cc(C)nc(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H23F3N4O/c1-3-16-9-4-5-10-27(16)18(28)17-11-13(2)24-19(26-17)25-15-8-6-7-14(12-15)20(21,22)23/h6-8,11-12,16H,3-5,9-10H2,1-2H3,(H,24,25,26) |
| InChIKey | ACJITLZOFDFXCR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |