C14H18O3 — CID 10933414
(5E)-5-methoxy-1-methyl-1,2,3,8,9,10-hexahydrobenzo[8]annulene-4,7-dione (PubChem CID 10933414) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (5E)-5-methoxy-1-methyl-1,2,3,8,9,10-hexahydrobenzo[8]annulene-4,7-dione.
| Compound Name | (5E)-5-methoxy-1-methyl-1,2,3,8,9,10-hexahydrobenzo[8]annulene-4,7-dione |
|---|---|
| PubChem CID | 10933414 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (5E)-5-methoxy-1-methyl-1,2,3,8,9,10-hexahydrobenzo[8]annulene-4,7-dione |
| SMILES | CO/C1=C/C(=O)CCCC2=C1C(=O)CCC2C |
| InChI | InChI=1S/C14H18O3/c1-9-6-7-12(16)14-11(9)5-3-4-10(15)8-13(14)17-2/h8-9H,3-7H2,1-2H3/b13-8+ |
| InChIKey | NUKNIQFWNBUDDU-MDWZMJQESA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |