C17H24N2O5S — CID 1093344
N-cyclopropyl-1-(2,5-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 1093344) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-cyclopropyl-1-(2,5-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-cyclopropyl-1-(2,5-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 1093344 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-cyclopropyl-1-(2,5-dimethoxyphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCC(C(=O)NC3CC3)CC2)c1 |
| InChI | InChI=1S/C17H24N2O5S/c1-23-14-5-6-15(24-2)16(11-14)25(21,22)19-9-7-12(8-10-19)17(20)18-13-3-4-13/h5-6,11-13H,3-4,7-10H2,1-2H3,(H,18,20) |
| InChIKey | UTPOLAKJODPTLL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |