C18H20Cl2N4O — CID 109334507
azepan-1-yl-[2-(3,4-dichloroanilino)-6-methylpyrimidin-4-yl]methanone (PubChem CID 109334507) has the molecular formula C18H20Cl2N4O and a molecular weight of 379.29 g/mol. Its IUPAC name is azepan-1-yl-[2-(3,4-dichloroanilino)-6-methylpyrimidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[2-(3,4-dichloroanilino)-6-methylpyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109334507 |
| Molecular Formula | C18H20Cl2N4O |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | azepan-1-yl-[2-(3,4-dichloroanilino)-6-methylpyrimidin-4-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCCCCC2)nc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H20Cl2N4O/c1-12-10-16(17(25)24-8-4-2-3-5-9-24)23-18(21-12)22-13-6-7-14(19)15(20)11-13/h6-7,10-11H,2-5,8-9H2,1H3,(H,21,22,23) |
| InChIKey | JJXVDNMABTXLEX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |