C14H20O3 — CID 10933480
(4'aR)-1',4'a-dimethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one (PubChem CID 10933480) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (4'aR)-1',4'a-dimethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one.
| Compound Name | (4'aR)-1',4'a-dimethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 10933480 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (4'aR)-1',4'a-dimethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one |
| SMILES | CC1=C2CCC3(C[C@@]2(C)CCC1=O)OCCO3 |
| InChI | InChI=1S/C14H20O3/c1-10-11-3-6-14(16-7-8-17-14)9-13(11,2)5-4-12(10)15/h3-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | CUGJRYXMCBJZTK-CYBMUJFWSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |