C14H20O3 — CID 10933487
(1R,4R,8S,11S)-4-methoxy-1,10-dimethyl-3-oxatricyclo[6.3.1.04,11]dodec-9-en-5-one (PubChem CID 10933487) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1R,4R,8S,11S)-4-methoxy-1,10-dimethyl-3-oxatricyclo[6.3.1.04,11]dodec-9-en-5-one.
| Compound Name | (1R,4R,8S,11S)-4-methoxy-1,10-dimethyl-3-oxatricyclo[6.3.1.04,11]dodec-9-en-5-one |
|---|---|
| PubChem CID | 10933487 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1R,4R,8S,11S)-4-methoxy-1,10-dimethyl-3-oxatricyclo[6.3.1.04,11]dodec-9-en-5-one |
| SMILES | CO[C@@]12OC[C@]3(C)C[C@@H](C=C(C)[C@@H]31)CCC2=O |
| InChI | InChI=1S/C14H20O3/c1-9-6-10-4-5-11(15)14(16-3)12(9)13(2,7-10)8-17-14/h6,10,12H,4-5,7-8H2,1-3H3/t10-,12+,13+,14+/m1/s1 |
| InChIKey | HGJZPYGRFOBVHN-SAXRGWBVSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|