C22H22N4O3 — CID 109334961
ethyl 2-[[6-methyl-2-(3-methylanilino)pyrimidine-4-carbonyl]amino]benzoate (PubChem CID 109334961) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl 2-[[6-methyl-2-(3-methylanilino)pyrimidine-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[6-methyl-2-(3-methylanilino)pyrimidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109334961 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | ethyl 2-[[6-methyl-2-(3-methylanilino)pyrimidine-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cc(C)nc(Nc2cccc(C)c2)n1 |
| InChI | InChI=1S/C22H22N4O3/c1-4-29-21(28)17-10-5-6-11-18(17)25-20(27)19-13-15(3)23-22(26-19)24-16-9-7-8-14(2)12-16/h5-13H,4H2,1-3H3,(H,25,27)(H,23,24,26) |
| InChIKey | JLHPUZXXEZAHTF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |