C13H18O4 — CID 10933549
(1S,6R,8R)-3,3-dimethyl-2,12-dioxatricyclo[6.5.0.01,6]tridecane-5,13-dione (PubChem CID 10933549) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1S,6R,8R)-3,3-dimethyl-2,12-dioxatricyclo[6.5.0.01,6]tridecane-5,13-dione.
| Compound Name | (1S,6R,8R)-3,3-dimethyl-2,12-dioxatricyclo[6.5.0.01,6]tridecane-5,13-dione |
|---|---|
| PubChem CID | 10933549 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1S,6R,8R)-3,3-dimethyl-2,12-dioxatricyclo[6.5.0.01,6]tridecane-5,13-dione |
| SMILES | CC1(C)CC(=O)[C@@H]2C[C@H]3CCCOC(=O)[C@]32O1 |
| InChI | InChI=1S/C13H18O4/c1-12(2)7-10(14)9-6-8-4-3-5-16-11(15)13(8,9)17-12/h8-9H,3-7H2,1-2H3/t8-,9+,13+/m1/s1 |
| InChIKey | XDUBIOPOMUMBPH-ZDMBXUJBSA-N |
| XLogP | 1.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |