C10H11BrFN — CID 10933703
8-bromo-4-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine (PubChem CID 10933703) has the molecular formula C10H11BrFN and a molecular weight of 244.11 g/mol. Its IUPAC name is 8-bromo-4-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine.
| Compound Name | 8-bromo-4-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine |
|---|---|
| PubChem CID | 10933703 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 8-bromo-4-fluoro-2,3,4,5-tetrahydro-1H-2-benzazepine |
| SMILES | FC1CNCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C10H11BrFN/c11-9-2-1-7-4-10(12)6-13-5-8(7)3-9/h1-3,10,13H,4-6H2 |
| InChIKey | OOYOOYBFEFELCQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |