C21H19ClN4O2 — CID 109337269
N-(3-acetylphenyl)-2-(4-chloro-2-methylanilino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109337269) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(4-chloro-2-methylanilino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-2-(4-chloro-2-methylanilino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109337269 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-(3-acetylphenyl)-2-(4-chloro-2-methylanilino)-6-methylpyrimidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cc(C)nc(Nc3ccc(Cl)cc3C)n2)c1 |
| InChI | InChI=1S/C21H19ClN4O2/c1-12-9-16(22)7-8-18(12)25-21-23-13(2)10-19(26-21)20(28)24-17-6-4-5-15(11-17)14(3)27/h4-11H,1-3H3,(H,24,28)(H,23,25,26) |
| InChIKey | MDHJHCLMIPGMMQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |