C21H22N4O3 — CID 109337457
2-(4-ethoxyanilino)-N-(2-methoxyphenyl)-6-methylpyrimidine-4-carboxamide (PubChem CID 109337457) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-(4-ethoxyanilino)-N-(2-methoxyphenyl)-6-methylpyrimidine-4-carboxamide.
| Compound Name | 2-(4-ethoxyanilino)-N-(2-methoxyphenyl)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109337457 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-(4-ethoxyanilino)-N-(2-methoxyphenyl)-6-methylpyrimidine-4-carboxamide |
| SMILES | CCOc1ccc(Nc2nc(C)cc(C(=O)Nc3ccccc3OC)n2)cc1 |
| InChI | InChI=1S/C21H22N4O3/c1-4-28-16-11-9-15(10-12-16)23-21-22-14(2)13-18(25-21)20(26)24-17-7-5-6-8-19(17)27-3/h5-13H,4H2,1-3H3,(H,24,26)(H,22,23,25) |
| InChIKey | DGPYARDZBGUSAG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |