C16H12F3N5O2 — CID 109338228
6-methyl-2-[(5-methyl-1,2-oxazol-3-yl)amino]-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide (PubChem CID 109338228) has the molecular formula C16H12F3N5O2 and a molecular weight of 363.30 g/mol. Its IUPAC name is 6-methyl-2-[(5-methyl-1,2-oxazol-3-yl)amino]-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-methyl-2-[(5-methyl-1,2-oxazol-3-yl)amino]-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109338228 |
| Molecular Formula | C16H12F3N5O2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 6-methyl-2-[(5-methyl-1,2-oxazol-3-yl)amino]-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(F)c(F)c2F)nc(Nc2cc(C)on2)n1 |
| InChI | InChI=1S/C16H12F3N5O2/c1-7-5-11(22-16(20-7)23-12-6-8(2)26-24-12)15(25)21-10-4-3-9(17)13(18)14(10)19/h3-6H,1-2H3,(H,21,25)(H,20,22,23,24) |
| InChIKey | BVXKWQCXAUELJQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|