C11H16N4O — CID 109338241
N-prop-2-enyl-6-(propylamino)pyrimidine-4-carboxamide (PubChem CID 109338241) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is N-prop-2-enyl-6-(propylamino)pyrimidine-4-carboxamide.
| Compound Name | N-prop-2-enyl-6-(propylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109338241 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | N-prop-2-enyl-6-(propylamino)pyrimidine-4-carboxamide |
| SMILES | C=CCNC(=O)c1cc(NCCC)ncn1 |
| InChI | InChI=1S/C11H16N4O/c1-3-5-12-10-7-9(14-8-15-10)11(16)13-6-4-2/h4,7-8H,2-3,5-6H2,1H3,(H,13,16)(H,12,14,15) |
| InChIKey | MXKWLZKABIQDPD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|