About 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine
3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine (PubChem CID 10933868) has the molecular formula C17H16N2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine.
Molecular Properties
| Compound Name | 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine |
| PubChem CID | 10933868 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine |
| SMILES | CCC1=CN2CCC3=c4ccccc4=NC3=C2C=C1 |
| InChI | InChI=1S/C17H16N2/c1-2-12-7-8-16-17-14(9-10-19(16)11-12)13-5-3-4-6-15(13)18-17/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | DAGPUIPHACXCSU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine?
The IUPAC name of 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine (CID 10933868) is 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine.
What is the SMILES notation for 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine?
The canonical SMILES for 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine is CCC1=CN2CCC3=c4ccccc4=NC3=C2C=C1.
What is the InChIKey of 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine?
The InChIKey is DAGPUIPHACXCSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2/c1-2-12-7-8-16-17-14(9-10-19(16)11-12)13-5-3-4-6-15(13)18-17/h3-8,11H,2,9-10H2,1H3.
What are the key properties of 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine?
3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine has a molecular weight of 248.33 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6,7-dihydroindolo[2,3-a]quinolizine is sourced from PubChem (CID 10933868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).